C18H14O6 — CID 11834369
2-(1,3-benzodioxol-5-yl)-7,8-dimethoxychromen-4-one (PubChem CID 11834369) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-7,8-dimethoxychromen-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-7,8-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 11834369 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-7,8-dimethoxychromen-4-one |
| SMILES | COc1ccc2c(=O)cc(-c3ccc4c(c3)OCO4)oc2c1OC |
| InChI | InChI=1S/C18H14O6/c1-20-14-6-4-11-12(19)8-15(24-17(11)18(14)21-2)10-3-5-13-16(7-10)23-9-22-13/h3-8H,9H2,1-2H3 |
| InChIKey | TWGGDOYBQYZGQL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |