C19H12O6 — CID 12778488
2-(1,3-benzodioxol-5-yl)-5-methoxyfuro[2,3-h]chromen-4-one (PubChem CID 12778488) has the molecular formula C19H12O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-methoxyfuro[2,3-h]chromen-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-methoxyfuro[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 12778488 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-methoxyfuro[2,3-h]chromen-4-one |
| SMILES | COc1cc2occc2c2oc(-c3ccc4c(c3)OCO4)cc(=O)c12 |
| InChI | InChI=1S/C19H12O6/c1-21-17-8-15-11(4-5-22-15)19-18(17)12(20)7-14(25-19)10-2-3-13-16(6-10)24-9-23-13/h2-8H,9H2,1H3 |
| InChIKey | KXMKNCBSCHINMT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |