C12H14ClNO4 — CID 82020834
2-(aminomethyl)-7,8-dimethoxychromen-4-one;hydrochloride (PubChem CID 82020834) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-(aminomethyl)-7,8-dimethoxychromen-4-one;hydrochloride.
| Compound Name | 2-(aminomethyl)-7,8-dimethoxychromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 82020834 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(aminomethyl)-7,8-dimethoxychromen-4-one;hydrochloride |
| SMILES | COc1ccc2c(=O)cc(CN)oc2c1OC.Cl |
| InChI | InChI=1S/C12H13NO4.ClH/c1-15-10-4-3-8-9(14)5-7(6-13)17-11(8)12(10)16-2;/h3-5H,6,13H2,1-2H3;1H |
| InChIKey | MVMUIGRTKOMFGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |