C13H15NO3 — CID 3050900
8-(aminomethyl)-7-methoxy-2,3-dimethylchromen-4-one (PubChem CID 3050900) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 8-(aminomethyl)-7-methoxy-2,3-dimethylchromen-4-one.
| Compound Name | 8-(aminomethyl)-7-methoxy-2,3-dimethylchromen-4-one |
|---|---|
| PubChem CID | 3050900 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 8-(aminomethyl)-7-methoxy-2,3-dimethylchromen-4-one |
| SMILES | COc1ccc2c(=O)c(C)c(C)oc2c1CN |
| InChI | InChI=1S/C13H15NO3/c1-7-8(2)17-13-9(12(7)15)4-5-11(16-3)10(13)6-14/h4-5H,6,14H2,1-3H3 |
| InChIKey | SUSMRUPDOFTSQX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |