C10H15NO4S — CID 117365219
(3,6-dimethoxy-2-methylsulfonylphenyl)methanamine (PubChem CID 117365219) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (3,6-dimethoxy-2-methylsulfonylphenyl)methanamine.
| Compound Name | (3,6-dimethoxy-2-methylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 117365219 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3,6-dimethoxy-2-methylsulfonylphenyl)methanamine |
| SMILES | COc1ccc(OC)c(S(C)(=O)=O)c1CN |
| InChI | InChI=1S/C10H15NO4S/c1-14-8-4-5-9(15-2)10(7(8)6-11)16(3,12)13/h4-5H,6,11H2,1-3H3 |
| InChIKey | ACCFCEWAGGLYIG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |