C11H15NO6S — CID 117467276
2-amino-2-(3,6-dimethoxy-2-methylsulfonylphenyl)acetic acid (PubChem CID 117467276) has the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-amino-2-(3,6-dimethoxy-2-methylsulfonylphenyl)acetic acid.
| Compound Name | 2-amino-2-(3,6-dimethoxy-2-methylsulfonylphenyl)acetic acid |
|---|---|
| PubChem CID | 117467276 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-amino-2-(3,6-dimethoxy-2-methylsulfonylphenyl)acetic acid |
| SMILES | COc1ccc(OC)c(S(C)(=O)=O)c1C(N)C(=O)O |
| InChI | InChI=1S/C11H15NO6S/c1-17-6-4-5-7(18-2)10(19(3,15)16)8(6)9(12)11(13)14/h4-5,9H,12H2,1-3H3,(H,13,14) |
| InChIKey | NUTKLUMUTGCZRA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |