C11H13NO6 — CID 66512743
(2S)-2-amino-2-[6-(carboxymethyl)-2-hydroxy-3-methoxyphenyl]acetic acid (PubChem CID 66512743) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2S)-2-amino-2-[6-(carboxymethyl)-2-hydroxy-3-methoxyphenyl]acetic acid.
| Compound Name | (2S)-2-amino-2-[6-(carboxymethyl)-2-hydroxy-3-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 66512743 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (2S)-2-amino-2-[6-(carboxymethyl)-2-hydroxy-3-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)c([C@H](N)C(=O)O)c1O |
| InChI | InChI=1S/C11H13NO6/c1-18-6-3-2-5(4-7(13)14)8(10(6)15)9(12)11(16)17/h2-3,9,15H,4,12H2,1H3,(H,13,14)(H,16,17)/t9-/m0/s1 |
| InChIKey | ZHZXZCCVPZBEIU-VIFPVBQESA-N |
| XLogP | 0.11 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|