C10H12BrNO3 — CID 84713752
2-amino-2-(2-bromo-3-methoxy-6-methylphenyl)acetic acid (PubChem CID 84713752) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-amino-2-(2-bromo-3-methoxy-6-methylphenyl)acetic acid.
| Compound Name | 2-amino-2-(2-bromo-3-methoxy-6-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 84713752 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-amino-2-(2-bromo-3-methoxy-6-methylphenyl)acetic acid |
| SMILES | COc1ccc(C)c(C(N)C(=O)O)c1Br |
| InChI | InChI=1S/C10H12BrNO3/c1-5-3-4-6(15-2)8(11)7(5)9(12)10(13)14/h3-4,9H,12H2,1-2H3,(H,13,14) |
| InChIKey | IHGLUUTVNJVFJS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |