C14H17NO4 — CID 106888714
[5-(2,3,4-trimethoxyphenyl)furan-2-yl]methanamine (PubChem CID 106888714) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [5-(2,3,4-trimethoxyphenyl)furan-2-yl]methanamine.
| Compound Name | [5-(2,3,4-trimethoxyphenyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 106888714 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [5-(2,3,4-trimethoxyphenyl)furan-2-yl]methanamine |
| SMILES | COc1ccc(-c2ccc(CN)o2)c(OC)c1OC |
| InChI | InChI=1S/C14H17NO4/c1-16-12-7-5-10(13(17-2)14(12)18-3)11-6-4-9(8-15)19-11/h4-7H,8,15H2,1-3H3 |
| InChIKey | YBTSZGOJKOTZGL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |