About [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine
[5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine (PubChem CID 106888910) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine |
| PubChem CID | 106888910 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine |
| SMILES | Cc1c(-c2ccc(CN)o2)cnn1C |
| InChI | InChI=1S/C10H13N3O/c1-7-9(6-12-13(7)2)10-4-3-8(5-11)14-10/h3-4,6H,5,11H2,1-2H3 |
| InChIKey | LAKGEQFEAFLHJL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine?
The IUPAC name of [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine (CID 106888910) is [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine.
What is the SMILES notation for [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine?
The canonical SMILES for [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine is Cc1c(-c2ccc(CN)o2)cnn1C.
What is the InChIKey of [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine?
The InChIKey is LAKGEQFEAFLHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7-9(6-12-13(7)2)10-4-3-8(5-11)14-10/h3-4,6H,5,11H2,1-2H3.
What are the key properties of [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine?
[5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine has a molecular weight of 191.23 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,5-dimethylpyrazol-4-yl)furan-2-yl]methanamine is sourced from PubChem (CID 106888910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).