C23H24O8 — CID 162658811
(2-ethyl-7-methoxy-4-oxochromen-8-yl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 162658811) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is (2-ethyl-7-methoxy-4-oxochromen-8-yl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (2-ethyl-7-methoxy-4-oxochromen-8-yl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 162658811 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (2-ethyl-7-methoxy-4-oxochromen-8-yl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | CCc1cc(=O)c2ccc(OC)c(COC(=O)c3cc(OC)c(OC)c(OC)c3)c2o1 |
| InChI | InChI=1S/C23H24O8/c1-6-14-11-17(24)15-7-8-18(26-2)16(21(15)31-14)12-30-23(25)13-9-19(27-3)22(29-5)20(10-13)28-4/h7-11H,6,12H2,1-5H3 |
| InChIKey | SDWCUJUFYGYTJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |