C18H19BrO6 — CID 9201420
(5-bromo-2-methoxyphenyl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 9201420) has the molecular formula C18H19BrO6 and a molecular weight of 411.25 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 9201420 |
| Molecular Formula | C18H19BrO6 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(Br)cc1COC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H19BrO6/c1-21-14-6-5-13(19)7-12(14)10-25-18(20)11-8-15(22-2)17(24-4)16(9-11)23-3/h5-9H,10H2,1-4H3 |
| InChIKey | UVVAIRHWIFXQAI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |