C23H27BrO5 — CID 91720806
2-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-heptyl benzene-1,2-dicarboxylate (PubChem CID 91720806) has the molecular formula C23H27BrO5 and a molecular weight of 463.37 g/mol. Its IUPAC name is 2-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-heptyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-heptyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720806 |
| Molecular Formula | C23H27BrO5 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-heptyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccccc1C(=O)OCc1cc(Br)ccc1OC |
| InChI | InChI=1S/C23H27BrO5/c1-3-4-5-6-9-14-28-22(25)19-10-7-8-11-20(19)23(26)29-16-17-15-18(24)12-13-21(17)27-2/h7-8,10-13,15H,3-6,9,14,16H2,1-2H3 |
| InChIKey | UKBJSLYDLFRGAF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|