About 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate
4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate (PubChem CID 91702955) has the molecular formula C22H33BrO5
and a molecular weight of 457.41 g/mol. Its IUPAC name is 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate |
| PubChem CID | 91702955 |
| Molecular Formula | C22H33BrO5 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCC(=O)OCc1cc(Br)ccc1OC |
| InChI | InChI=1S/C22H33BrO5/c1-3-4-5-6-7-8-9-10-15-27-21(24)13-14-22(25)28-17-18-16-19(23)11-12-20(18)26-2/h11-12,16H,3-10,13-15,17H2,1-2H3 |
| InChIKey | HPRHLTRYAVMDRZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate?
The IUPAC name of 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate (CID 91702955) is 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate.
What is the SMILES notation for 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate?
The canonical SMILES for 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate is CCCCCCCCCCOC(=O)CCC(=O)OCc1cc(Br)ccc1OC.
What is the InChIKey of 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate?
The InChIKey is HPRHLTRYAVMDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33BrO5/c1-3-4-5-6-7-8-9-10-15-27-21(24)13-14-22(25)28-17-18-16-19(23)11-12-20(18)26-2/h11-12,16H,3-10,13-15,17H2,1-2H3.
What are the key properties of 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate?
4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate has a molecular weight of 457.41 g/mol, XLogP of 5.97, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(5-bromo-2-methoxyphenyl)methyl] 1-O-decyl butanedioate is sourced from PubChem (CID 91702955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).