About 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate
1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate (PubChem CID 91708965) has the molecular formula C17H23BrO5
and a molecular weight of 387.27 g/mol. Its IUPAC name is 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate |
| PubChem CID | 91708965 |
| Molecular Formula | C17H23BrO5 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate |
| SMILES | COc1ccc(Br)cc1COC(=O)CCCC(=O)OCC(C)C |
| InChI | InChI=1S/C17H23BrO5/c1-12(2)10-22-16(19)5-4-6-17(20)23-11-13-9-14(18)7-8-15(13)21-3/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | FBTOMIGOVABURO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate?
The IUPAC name of 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate (CID 91708965) is 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate.
What is the SMILES notation for 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate?
The canonical SMILES for 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate is COc1ccc(Br)cc1COC(=O)CCCC(=O)OCC(C)C.
What is the InChIKey of 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate?
The InChIKey is FBTOMIGOVABURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrO5/c1-12(2)10-22-16(19)5-4-6-17(20)23-11-13-9-14(18)7-8-15(13)21-3/h7-9,12H,4-6,10-11H2,1-3H3.
What are the key properties of 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate?
1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate has a molecular weight of 387.27 g/mol, XLogP of 3.87, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(5-bromo-2-methoxyphenyl)methyl] 5-O-(2-methylpropyl) pentanedioate is sourced from PubChem (CID 91708965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).