C10H8BrF3O3 — CID 91742074
(5-bromo-2-methoxyphenyl)methyl 2,2,2-trifluoroacetate (PubChem CID 91742074) has the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl 2,2,2-trifluoroacetate.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91742074 |
| Molecular Formula | C10H8BrF3O3 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(Br)cc1COC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8BrF3O3/c1-16-8-3-2-7(11)4-6(8)5-17-9(15)10(12,13)14/h2-4H,5H2,1H3 |
| InChIKey | XUQMLLYPCPUQJB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |