C11H10BrF3O2 — CID 54971223
1-(5-bromo-2-methoxyphenyl)-4,4,4-trifluorobutan-2-one (PubChem CID 54971223) has the molecular formula C11H10BrF3O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-4,4,4-trifluorobutan-2-one.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-4,4,4-trifluorobutan-2-one |
|---|---|
| PubChem CID | 54971223 |
| Molecular Formula | C11H10BrF3O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-4,4,4-trifluorobutan-2-one |
| SMILES | COc1ccc(Br)cc1CC(=O)CC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O2/c1-17-10-3-2-8(12)4-7(10)5-9(16)6-11(13,14)15/h2-4H,5-6H2,1H3 |
| InChIKey | YGWIUHXNMQEUAY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |