C9H5BrF4O2 — CID 91735693
(2-bromo-5-fluorophenyl)methyl 2,2,2-trifluoroacetate (PubChem CID 91735693) has the molecular formula C9H5BrF4O2 and a molecular weight of 301.03 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)methyl 2,2,2-trifluoroacetate.
| Compound Name | (2-bromo-5-fluorophenyl)methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91735693 |
| Molecular Formula | C9H5BrF4O2 |
| Molecular Weight | 301.03 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | (2-bromo-5-fluorophenyl)methyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCc1cc(F)ccc1Br)C(F)(F)F |
| InChI | InChI=1S/C9H5BrF4O2/c10-7-2-1-6(11)3-5(7)4-16-8(15)9(12,13)14/h1-3H,4H2 |
| InChIKey | TZMKLUQBEDIIER-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |