C12H13F3O2 — CID 121010007
(2,4,5-trimethylphenyl)methyl 2,2,2-trifluoroacetate (PubChem CID 121010007) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is (2,4,5-trimethylphenyl)methyl 2,2,2-trifluoroacetate.
| Compound Name | (2,4,5-trimethylphenyl)methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 121010007 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2,4,5-trimethylphenyl)methyl 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(C)c(COC(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C12H13F3O2/c1-7-4-9(3)10(5-8(7)2)6-17-11(16)12(13,14)15/h4-5H,6H2,1-3H3 |
| InChIKey | KLFVXDQCJHPHSA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |