C17H13F5O5 — CID 8013600
(2,3,4,5,6-pentafluorophenyl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 8013600) has the molecular formula C17H13F5O5 and a molecular weight of 392.28 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013600 |
| Molecular Formula | C17H13F5O5 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H13F5O5/c1-24-9-4-7(5-10(25-2)16(9)26-3)17(23)27-6-8-11(18)13(20)15(22)14(21)12(8)19/h4-5H,6H2,1-3H3 |
| InChIKey | GPWKKGWPEFGHCP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|