C23H22O8 — CID 84559516
(4-oxo-5-phenylmethoxypyran-2-yl)methyl 3,4,5-trimethoxybenzoate (PubChem CID 84559516) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3,4,5-trimethoxybenzoate.
| Compound Name | (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 84559516 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)c(OCc3ccccc3)co2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22O8/c1-26-19-9-16(10-20(27-2)22(19)28-3)23(25)31-13-17-11-18(24)21(14-29-17)30-12-15-7-5-4-6-8-15/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | LBASHEXMXMVABG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |