About (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate
(4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate (PubChem CID 84558880) has the molecular formula C20H15BrO5
and a molecular weight of 415.24 g/mol. Its IUPAC name is (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate.
Molecular Properties
| Compound Name | (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate |
| PubChem CID | 84558880 |
| Molecular Formula | C20H15BrO5 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate |
| SMILES | O=C(OCc1cc(=O)c(OCc2ccccc2)co1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H15BrO5/c21-16-8-4-7-15(9-16)20(23)26-12-17-10-18(22)19(13-24-17)25-11-14-5-2-1-3-6-14/h1-10,13H,11-12H2 |
| InChIKey | IHCFNEHFBUKREY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate?
The IUPAC name of (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate (CID 84558880) is (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate.
What is the SMILES notation for (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate?
The canonical SMILES for (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate is O=C(OCc1cc(=O)c(OCc2ccccc2)co1)c1cccc(Br)c1.
What is the InChIKey of (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate?
The InChIKey is IHCFNEHFBUKREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrO5/c21-16-8-4-7-15(9-16)20(23)26-12-17-10-18(22)19(13-24-17)25-11-14-5-2-1-3-6-14/h1-10,13H,11-12H2.
What are the key properties of (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate?
(4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate has a molecular weight of 415.24 g/mol, XLogP of 4.34, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-5-phenylmethoxypyran-2-yl)methyl 3-bromobenzoate is sourced from PubChem (CID 84558880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).