C20H20O4 — CID 123388301
2-(hepta-1,3,5-trien-3-yloxymethyl)-5-phenylmethoxypyran-4-one (PubChem CID 123388301) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(hepta-1,3,5-trien-3-yloxymethyl)-5-phenylmethoxypyran-4-one.
| Compound Name | 2-(hepta-1,3,5-trien-3-yloxymethyl)-5-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 123388301 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(hepta-1,3,5-trien-3-yloxymethyl)-5-phenylmethoxypyran-4-one |
| SMILES | C=CC(=CC=CC)OCc1cc(=O)c(OCc2ccccc2)co1 |
| InChI | InChI=1S/C20H20O4/c1-3-5-11-17(4-2)22-14-18-12-19(21)20(15-23-18)24-13-16-9-7-6-8-10-16/h3-12,15H,2,13-14H2,1H3 |
| InChIKey | LAOBMTFHONADIT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|