C17H18O5 — CID 10614293
5-[(4-methoxyphenyl)methoxy]-2-(prop-2-enoxymethyl)pyran-4-one (PubChem CID 10614293) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methoxy]-2-(prop-2-enoxymethyl)pyran-4-one.
| Compound Name | 5-[(4-methoxyphenyl)methoxy]-2-(prop-2-enoxymethyl)pyran-4-one |
|---|---|
| PubChem CID | 10614293 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 5-[(4-methoxyphenyl)methoxy]-2-(prop-2-enoxymethyl)pyran-4-one |
| SMILES | C=CCOCc1cc(=O)c(OCc2ccc(OC)cc2)co1 |
| InChI | InChI=1S/C17H18O5/c1-3-8-20-11-15-9-16(18)17(12-21-15)22-10-13-4-6-14(19-2)7-5-13/h3-7,9,12H,1,8,10-11H2,2H3 |
| InChIKey | AATFSPJEYCVWEH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|