C26H28N2O5 — CID 16812841
methyl 4-[[6-[(4-benzylpiperazin-1-yl)methyl]-4-oxopyran-3-yl]oxymethyl]benzoate (PubChem CID 16812841) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl 4-[[6-[(4-benzylpiperazin-1-yl)methyl]-4-oxopyran-3-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[6-[(4-benzylpiperazin-1-yl)methyl]-4-oxopyran-3-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 16812841 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl 4-[[6-[(4-benzylpiperazin-1-yl)methyl]-4-oxopyran-3-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2coc(CN3CCN(Cc4ccccc4)CC3)cc2=O)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-31-26(30)22-9-7-21(8-10-22)18-33-25-19-32-23(15-24(25)29)17-28-13-11-27(12-14-28)16-20-5-3-2-4-6-20/h2-10,15,19H,11-14,16-18H2,1H3 |
| InChIKey | OMCAXPTTXVMCMI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |