C28H30N2O4 — CID 75159586
5-[(3,5-dimethylphenyl)methoxy]-2-[[4-(3-phenylprop-2-enoyl)piperazin-1-yl]methyl]pyran-4-one (PubChem CID 75159586) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenyl)methoxy]-2-[[4-(3-phenylprop-2-enoyl)piperazin-1-yl]methyl]pyran-4-one.
| Compound Name | 5-[(3,5-dimethylphenyl)methoxy]-2-[[4-(3-phenylprop-2-enoyl)piperazin-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 75159586 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 5-[(3,5-dimethylphenyl)methoxy]-2-[[4-(3-phenylprop-2-enoyl)piperazin-1-yl]methyl]pyran-4-one |
| SMILES | Cc1cc(C)cc(COc2coc(CN3CCN(C(=O)C=Cc4ccccc4)CC3)cc2=O)c1 |
| InChI | InChI=1S/C28H30N2O4/c1-21-14-22(2)16-24(15-21)19-34-27-20-33-25(17-26(27)31)18-29-10-12-30(13-11-29)28(32)9-8-23-6-4-3-5-7-23/h3-9,14-17,20H,10-13,18-19H2,1-2H3 |
| InChIKey | DSBFQQOVSQLGNV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|