C20H20O7 — CID 44584772
2-(3,4-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one (PubChem CID 44584772) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 44584772 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cc(OC)c(OC)c(OC)c3o2)cc1OC |
| InChI | InChI=1S/C20H20O7/c1-22-14-7-6-11(8-16(14)23-2)15-10-13(21)12-9-17(24-3)19(25-4)20(26-5)18(12)27-15/h6-10H,1-5H3 |
| InChIKey | MNQMRHVEXBTNRO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |