C21H22O7 — CID 176986827
2-[4-(1-hydroxyethyl)-3,5-bis(methoxymethoxy)phenyl]chromen-4-one (PubChem CID 176986827) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[4-(1-hydroxyethyl)-3,5-bis(methoxymethoxy)phenyl]chromen-4-one.
| Compound Name | 2-[4-(1-hydroxyethyl)-3,5-bis(methoxymethoxy)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 176986827 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[4-(1-hydroxyethyl)-3,5-bis(methoxymethoxy)phenyl]chromen-4-one |
| SMILES | COCOc1cc(-c2cc(=O)c3ccccc3o2)cc(OCOC)c1C(C)O |
| InChI | InChI=1S/C21H22O7/c1-13(22)21-19(26-11-24-2)8-14(9-20(21)27-12-25-3)18-10-16(23)15-6-4-5-7-17(15)28-18/h4-10,13,22H,11-12H2,1-3H3 |
| InChIKey | SYUNJRPXTLMUQA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|