About copper;2-phenylchromen-4-one
copper;2-phenylchromen-4-one (PubChem CID 175169427) has the molecular formula C15H10CuO2
and a molecular weight of 285.79 g/mol. Its IUPAC name is copper;2-phenylchromen-4-one.
Molecular Properties
| Compound Name | copper;2-phenylchromen-4-one |
| PubChem CID | 175169427 |
| Molecular Formula | C15H10CuO2 |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | copper;2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2ccccc12.[Cu] |
| InChI | InChI=1S/C15H10O2.Cu/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H; |
| InChIKey | XFLDRIMXMFEUDJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-phenylchromen-4-one?
The IUPAC name of copper;2-phenylchromen-4-one (CID 175169427) is copper;2-phenylchromen-4-one.
What is the SMILES notation for copper;2-phenylchromen-4-one?
The canonical SMILES for copper;2-phenylchromen-4-one is O=c1cc(-c2ccccc2)oc2ccccc12.[Cu].
What is the InChIKey of copper;2-phenylchromen-4-one?
The InChIKey is XFLDRIMXMFEUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2.Cu/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H;.
What are the key properties of copper;2-phenylchromen-4-one?
copper;2-phenylchromen-4-one has a molecular weight of 285.79 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-phenylchromen-4-one is sourced from PubChem (CID 175169427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).