About 2-phenylchromen-4-one
2-phenylchromen-4-one (PubChem CID 90124083) has the molecular formula C30H20O4
and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 2-phenylchromen-4-one |
| PubChem CID | 90124083 |
| Molecular Formula | C30H20O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2ccccc12.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/2C15H10O2/c2*16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h2*1-10H |
| InChIKey | ABJJEPCCQQOWBG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylchromen-4-one?
The IUPAC name of 2-phenylchromen-4-one (CID 90124083) is 2-phenylchromen-4-one.
What is the SMILES notation for 2-phenylchromen-4-one?
The canonical SMILES for 2-phenylchromen-4-one is O=c1cc(-c2ccccc2)oc2ccccc12.O=c1cc(-c2ccccc2)oc2ccccc12.
What is the InChIKey of 2-phenylchromen-4-one?
The InChIKey is ABJJEPCCQQOWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H10O2/c2*16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h2*1-10H.
What are the key properties of 2-phenylchromen-4-one?
2-phenylchromen-4-one has a molecular weight of 444.49 g/mol, XLogP of 6.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylchromen-4-one is sourced from PubChem (CID 90124083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).