C23H17NO3 — CID 175495786
2,3-dihydroisoindol-1-one;2-phenylchromen-4-one (PubChem CID 175495786) has the molecular formula C23H17NO3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2,3-dihydroisoindol-1-one;2-phenylchromen-4-one.
| Compound Name | 2,3-dihydroisoindol-1-one;2-phenylchromen-4-one |
|---|---|
| PubChem CID | 175495786 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2,3-dihydroisoindol-1-one;2-phenylchromen-4-one |
| SMILES | O=C1NCc2ccccc21.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H10O2.C8H7NO/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;10-8-7-4-2-1-3-6(7)5-9-8/h1-10H;1-4H,5H2,(H,9,10) |
| InChIKey | SQGPSAOJWFZBKS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |