C11H11N3O3 — CID 117337654
5-(7-methoxy-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine (PubChem CID 117337654) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-(7-methoxy-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(7-methoxy-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117337654 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-(7-methoxy-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine |
| SMILES | COc1cc(-c2cc(N)n[nH]2)cc2c1OCO2 |
| InChI | InChI=1S/C11H11N3O3/c1-15-8-2-6(7-4-10(12)14-13-7)3-9-11(8)17-5-16-9/h2-4H,5H2,1H3,(H3,12,13,14) |
| InChIKey | IVDVWFOZCRZEBG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |