C10H8FN3O3 — CID 137017138
4-(3-amino-1H-pyrazol-5-yl)-6-fluoro-1,3-benzodioxol-5-ol (PubChem CID 137017138) has the molecular formula C10H8FN3O3 and a molecular weight of 237.19 g/mol. Its IUPAC name is 4-(3-amino-1H-pyrazol-5-yl)-6-fluoro-1,3-benzodioxol-5-ol.
| Compound Name | 4-(3-amino-1H-pyrazol-5-yl)-6-fluoro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 137017138 |
| Molecular Formula | C10H8FN3O3 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(3-amino-1H-pyrazol-5-yl)-6-fluoro-1,3-benzodioxol-5-ol |
| SMILES | Nc1cc(-c2c(O)c(F)cc3c2OCO3)[nH]n1 |
| InChI | InChI=1S/C10H8FN3O3/c11-4-1-6-10(17-3-16-6)8(9(4)15)5-2-7(12)14-13-5/h1-2,15H,3H2,(H3,12,13,14) |
| InChIKey | HUZBHFCSBMMBMV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |