C12H13N3O2 — CID 117334141
5-(6,7-dimethyl-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine (PubChem CID 117334141) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-(6,7-dimethyl-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(6,7-dimethyl-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117334141 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-(6,7-dimethyl-1,3-benzodioxol-5-yl)-1H-pyrazol-3-amine |
| SMILES | Cc1c(-c2cc(N)n[nH]2)cc2c(c1C)OCO2 |
| InChI | InChI=1S/C12H13N3O2/c1-6-7(2)12-10(16-5-17-12)3-8(6)9-4-11(13)15-14-9/h3-4H,5H2,1-2H3,(H3,13,14,15) |
| InChIKey | BOYOCHSEQLDUAL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |