C11H13N3O — CID 136998614
4-(3-amino-1H-pyrazol-5-yl)-2,3-dimethylphenol (PubChem CID 136998614) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(3-amino-1H-pyrazol-5-yl)-2,3-dimethylphenol.
| Compound Name | 4-(3-amino-1H-pyrazol-5-yl)-2,3-dimethylphenol |
|---|---|
| PubChem CID | 136998614 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-(3-amino-1H-pyrazol-5-yl)-2,3-dimethylphenol |
| SMILES | Cc1c(O)ccc(-c2cc(N)n[nH]2)c1C |
| InChI | InChI=1S/C11H13N3O/c1-6-7(2)10(15)4-3-8(6)9-5-11(12)14-13-9/h3-5,15H,1-2H3,(H3,12,13,14) |
| InChIKey | JYKOCLJOBIJZLS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |