C13H17N3O3 — CID 117412509
5-[3,4-dimethoxy-5-(methoxymethyl)phenyl]-1H-pyrazol-3-amine (PubChem CID 117412509) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-[3,4-dimethoxy-5-(methoxymethyl)phenyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[3,4-dimethoxy-5-(methoxymethyl)phenyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117412509 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-[3,4-dimethoxy-5-(methoxymethyl)phenyl]-1H-pyrazol-3-amine |
| SMILES | COCc1cc(-c2cc(N)n[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C13H17N3O3/c1-17-7-9-4-8(10-6-12(14)16-15-10)5-11(18-2)13(9)19-3/h4-6H,7H2,1-3H3,(H3,14,15,16) |
| InChIKey | MAIFHVCBBHYHNH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |