C12H14ClN3O2 — CID 117422703
5-(2-chloro-3,4-dimethoxy-6-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 117422703) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 5-(2-chloro-3,4-dimethoxy-6-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2-chloro-3,4-dimethoxy-6-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117422703 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-(2-chloro-3,4-dimethoxy-6-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1cc(C)c(-c2cc(N)n[nH]2)c(Cl)c1OC |
| InChI | InChI=1S/C12H14ClN3O2/c1-6-4-8(17-2)12(18-3)11(13)10(6)7-5-9(14)16-15-7/h4-5H,1-3H3,(H3,14,15,16) |
| InChIKey | KILRXXLLQMWACX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |