C12H14ClN3O3 — CID 117455942
5-(3-chloro-2,5,6-trimethoxyphenyl)-1H-pyrazol-3-amine (PubChem CID 117455942) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.72 g/mol. Its IUPAC name is 5-(3-chloro-2,5,6-trimethoxyphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(3-chloro-2,5,6-trimethoxyphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117455942 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-(3-chloro-2,5,6-trimethoxyphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1cc(Cl)c(OC)c(-c2cc(N)n[nH]2)c1OC |
| InChI | InChI=1S/C12H14ClN3O3/c1-17-8-4-6(13)11(18-2)10(12(8)19-3)7-5-9(14)16-15-7/h4-5H,1-3H3,(H3,14,15,16) |
| InChIKey | PAMLPOSLEPPWNH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |