C11H12ClN3O3S — CID 117485866
5-(3-chloro-4-methoxy-5-methylsulfonylphenyl)-1H-pyrazol-3-amine (PubChem CID 117485866) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxy-5-methylsulfonylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(3-chloro-4-methoxy-5-methylsulfonylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117485866 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 5-(3-chloro-4-methoxy-5-methylsulfonylphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1c(Cl)cc(-c2cc(N)n[nH]2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C11H12ClN3O3S/c1-18-11-7(12)3-6(4-9(11)19(2,16)17)8-5-10(13)15-14-8/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | UXSDRTQEUZJNQA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |