C10H10FN3O2S — CID 117390822
5-(2-fluoro-6-methylsulfonylphenyl)-1H-pyrazol-3-amine (PubChem CID 117390822) has the molecular formula C10H10FN3O2S and a molecular weight of 255.27 g/mol. Its IUPAC name is 5-(2-fluoro-6-methylsulfonylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2-fluoro-6-methylsulfonylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117390822 |
| Molecular Formula | C10H10FN3O2S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 5-(2-fluoro-6-methylsulfonylphenyl)-1H-pyrazol-3-amine |
| SMILES | CS(=O)(=O)c1cccc(F)c1-c1cc(N)n[nH]1 |
| InChI | InChI=1S/C10H10FN3O2S/c1-17(15,16)8-4-2-3-6(11)10(8)7-5-9(12)14-13-7/h2-5H,1H3,(H3,12,13,14) |
| InChIKey | REHQPZXNONMHGY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |