C13H13N7O2S — CID 122694139
4-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]pyridine-2,6-diamine (PubChem CID 122694139) has the molecular formula C13H13N7O2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 4-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]pyridine-2,6-diamine.
| Compound Name | 4-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 122694139 |
| Molecular Formula | C13H13N7O2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]pyridine-2,6-diamine |
| SMILES | CS(=O)(=O)c1cccc(-c2cc(N)nc(N)c2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C13H13N7O2S/c1-23(21,22)9-4-2-3-8(12(9)13-17-19-20-18-13)7-5-10(14)16-11(15)6-7/h2-6H,1H3,(H4,14,15,16)(H,17,18,19,20) |
| InChIKey | DBJDMALUWUPSLC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |