C18H16N6O2S — CID 122694258
[6-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]isoquinolin-1-yl]methanamine (PubChem CID 122694258) has the molecular formula C18H16N6O2S and a molecular weight of 380.43 g/mol. Its IUPAC name is [6-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]isoquinolin-1-yl]methanamine.
| Compound Name | [6-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]isoquinolin-1-yl]methanamine |
|---|---|
| PubChem CID | 122694258 |
| Molecular Formula | C18H16N6O2S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [6-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]isoquinolin-1-yl]methanamine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc3c(CN)nccc3c2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C18H16N6O2S/c1-27(25,26)16-4-2-3-14(17(16)18-21-23-24-22-18)11-5-6-13-12(9-11)7-8-20-15(13)10-19/h2-9H,10,19H2,1H3,(H,21,22,23,24) |
| InChIKey | ZZVKTPSYFCYMID-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |