C16H12N6O2S — CID 122694184
6-[2-methylsulfonyl-3-(2H-tetrazol-5-yl)-4-pyridinyl]quinoline (PubChem CID 122694184) has the molecular formula C16H12N6O2S and a molecular weight of 352.38 g/mol. Its IUPAC name is 6-[2-methylsulfonyl-3-(2H-tetrazol-5-yl)-4-pyridinyl]quinoline.
| Compound Name | 6-[2-methylsulfonyl-3-(2H-tetrazol-5-yl)-4-pyridinyl]quinoline |
|---|---|
| PubChem CID | 122694184 |
| Molecular Formula | C16H12N6O2S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 6-[2-methylsulfonyl-3-(2H-tetrazol-5-yl)-4-pyridinyl]quinoline |
| SMILES | CS(=O)(=O)c1nccc(-c2ccc3ncccc3c2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C16H12N6O2S/c1-25(23,24)16-14(15-19-21-22-20-15)12(6-8-18-16)10-4-5-13-11(9-10)3-2-7-17-13/h2-9H,1H3,(H,19,20,21,22) |
| InChIKey | FWYMDGBWJGHQQA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |