C15H11N5O2S2 — CID 122694319
2-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]thieno[3,2-c]pyridine (PubChem CID 122694319) has the molecular formula C15H11N5O2S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]thieno[3,2-c]pyridine.
| Compound Name | 2-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 122694319 |
| Molecular Formula | C15H11N5O2S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[3-methylsulfonyl-2-(2H-tetrazol-5-yl)phenyl]thieno[3,2-c]pyridine |
| SMILES | CS(=O)(=O)c1cccc(-c2cc3cnccc3s2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C15H11N5O2S2/c1-24(21,22)13-4-2-3-10(14(13)15-17-19-20-18-15)12-7-9-8-16-6-5-11(9)23-12/h2-8H,1H3,(H,17,18,19,20) |
| InChIKey | ZDTSGNJQWLBUQF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |