C14H15ClN4O — CID 84743751
5-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)-1H-pyrazol-3-amine (PubChem CID 84743751) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is 5-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 84743751 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)-1H-pyrazol-3-amine |
| SMILES | COc1cc2c(-c3cc(N)n[nH]3)c(C)n(C)c2cc1Cl |
| InChI | InChI=1S/C14H15ClN4O/c1-7-14(10-6-13(16)18-17-10)8-4-12(20-3)9(15)5-11(8)19(7)2/h4-6H,1-3H3,(H3,16,17,18) |
| InChIKey | IODCKPJRHZBZKF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |