C15H18ClNO3 — CID 143225852
ethyl 2-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)acetate (PubChem CID 143225852) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is ethyl 2-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)acetate.
| Compound Name | ethyl 2-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)acetate |
|---|---|
| PubChem CID | 143225852 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | ethyl 2-(6-chloro-5-methoxy-1,2-dimethylindol-3-yl)acetate |
| SMILES | CCOC(=O)Cc1c(C)n(C)c2cc(Cl)c(OC)cc12 |
| InChI | InChI=1S/C15H18ClNO3/c1-5-20-15(18)7-10-9(2)17(3)13-8-12(16)14(19-4)6-11(10)13/h6,8H,5,7H2,1-4H3 |
| InChIKey | UZSWCBFDADHEPF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|