C17H13ClFNO4S — CID 18453737
2-[6-chloro-1-(5-fluorothiophene-3-carbonyl)-5-methoxy-2-methylindol-3-yl]acetic acid (PubChem CID 18453737) has the molecular formula C17H13ClFNO4S and a molecular weight of 381.81 g/mol. Its IUPAC name is 2-[6-chloro-1-(5-fluorothiophene-3-carbonyl)-5-methoxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-1-(5-fluorothiophene-3-carbonyl)-5-methoxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453737 |
| Molecular Formula | C17H13ClFNO4S |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-[6-chloro-1-(5-fluorothiophene-3-carbonyl)-5-methoxy-2-methylindol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)c3csc(F)c3)c2cc1Cl |
| InChI | InChI=1S/C17H13ClFNO4S/c1-8-10(5-16(21)22)11-4-14(24-2)12(18)6-13(11)20(8)17(23)9-3-15(19)25-7-9/h3-4,6-7H,5H2,1-2H3,(H,21,22) |
| InChIKey | YNXOZHOWYRNAIG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |