C20H15F4NO4 — CID 18453961
2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetic acid (PubChem CID 18453961) has the molecular formula C20H15F4NO4 and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453961 |
| Molecular Formula | C20H15F4NO4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)c3ccc(C(F)(F)F)cc3)c2cc1F |
| InChI | InChI=1S/C20H15F4NO4/c1-10-13(8-18(26)27)14-7-17(29-2)15(21)9-16(14)25(10)19(28)11-3-5-12(6-4-11)20(22,23)24/h3-7,9H,8H2,1-2H3,(H,26,27) |
| InChIKey | JQIOTRMIWOKOCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |