C21H19F2NO4 — CID 90928859
[3-(2,2-dihydroxyethyl)-6-fluoro-5-methoxy-2-methylindol-1-yl]-[4-(1-fluoroethenyl)phenyl]methanone (PubChem CID 90928859) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is [3-(2,2-dihydroxyethyl)-6-fluoro-5-methoxy-2-methylindol-1-yl]-[4-(1-fluoroethenyl)phenyl]methanone.
| Compound Name | [3-(2,2-dihydroxyethyl)-6-fluoro-5-methoxy-2-methylindol-1-yl]-[4-(1-fluoroethenyl)phenyl]methanone |
|---|---|
| PubChem CID | 90928859 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [3-(2,2-dihydroxyethyl)-6-fluoro-5-methoxy-2-methylindol-1-yl]-[4-(1-fluoroethenyl)phenyl]methanone |
| SMILES | C=C(F)c1ccc(C(=O)n2c(C)c(CC(O)O)c3cc(OC)c(F)cc32)cc1 |
| InChI | InChI=1S/C21H19F2NO4/c1-11(22)13-4-6-14(7-5-13)21(27)24-12(2)15(9-20(25)26)16-8-19(28-3)17(23)10-18(16)24/h4-8,10,20,25-26H,1,9H2,2-3H3 |
| InChIKey | CKIRJIZGRPFIQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|