C20H15FN2O4 — CID 18453572
2-[1-(4-cyanobenzoyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid (PubChem CID 18453572) has the molecular formula C20H15FN2O4 and a molecular weight of 366.35 g/mol. Its IUPAC name is 2-[1-(4-cyanobenzoyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[1-(4-cyanobenzoyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453572 |
| Molecular Formula | C20H15FN2O4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[1-(4-cyanobenzoyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)c3ccc(C#N)cc3)c2cc1F |
| InChI | InChI=1S/C20H15FN2O4/c1-11-14(8-19(24)25)15-7-18(27-2)16(21)9-17(15)23(11)20(26)13-5-3-12(10-22)4-6-13/h3-7,9H,8H2,1-2H3,(H,24,25) |
| InChIKey | KIDBPRLKWUSZMP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |